C14H12NNaO3S — CID 134876566
sodium (2-formylphenyl)-(4-methylphenyl)sulfonylazanide (PubChem CID 134876566) has the molecular formula C14H12NNaO3S and a molecular weight of 297.31 g/mol. Its IUPAC name is sodium (2-formylphenyl)-(4-methylphenyl)sulfonylazanide.
| Compound Name | sodium (2-formylphenyl)-(4-methylphenyl)sulfonylazanide |
|---|---|
| PubChem CID | 134876566 |
| Molecular Formula | C14H12NNaO3S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | sodium (2-formylphenyl)-(4-methylphenyl)sulfonylazanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]c2ccccc2C=O)cc1.[Na+] |
| InChI | InChI=1S/C14H13NO3S.Na/c1-11-6-8-13(9-7-11)19(17,18)15-14-5-3-2-4-12(14)10-16;/h2-10H,1H3,(H,15,16);/q;+1/p-1 |
| InChIKey | GADNTKIEDYPUKZ-UHFFFAOYSA-M |
| XLogP | 0.21 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|