C32H28AuN3O4S2 — CID 54679765
gold(3+);(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylphenyl]azanide;2-(phenylmethyl)pyridine (PubChem CID 54679765) has the molecular formula C32H28AuN3O4S2 and a molecular weight of 779.69 g/mol. Its IUPAC name is gold(3+);(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylphenyl]azanide;2-(phenylmethyl)pyridine.
| Compound Name | gold(3+);(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylphenyl]azanide;2-(phenylmethyl)pyridine |
|---|---|
| PubChem CID | 54679765 |
| Molecular Formula | C32H28AuN3O4S2 |
| Molecular Weight | 779.69 g/mol |
| Exact Mass | 779.12 |
| IUPAC Name | gold(3+);(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylphenyl]azanide;2-(phenylmethyl)pyridine |
| SMILES | Cc1ccc(S(=O)(=O)[N-]c2ccccc2[N-]S(=O)(=O)c2ccc(C)cc2)cc1.[Au+3].[c-]1ccccc1Cc1ccccn1 |
| InChI | InChI=1S/C20H18N2O4S2.C12H10N.Au/c1-15-7-11-17(12-8-15)27(23,24)21-19-5-3-4-6-20(19)22-28(25,26)18-13-9-16(2)10-14-18;1-2-6-11(7-3-1)10-12-8-4-5-9-13-12;/h3-14H,1-2H3;1-6,8-9H,10H2;/q-2;-1;+3 |
| InChIKey | VATKWGVLMZDGAR-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.69 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|