About chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine
chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine (PubChem CID 139242717) has the molecular formula C29H23ClN2O2PdS
and a molecular weight of 605.46 g/mol. Its IUPAC name is chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine.
Molecular Properties
| Compound Name | chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine |
| PubChem CID | 139242717 |
| Molecular Formula | C29H23ClN2O2PdS |
| Molecular Weight | 605.46 g/mol |
| Exact Mass | 604.02 |
| IUPAC Name | chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2-c2ccccn2)cc1.Cl[Pd+].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C18H15NO2S.C11H8N.ClH.Pd/c1-14-9-11-15(12-10-14)22(20,21)18-8-3-2-6-16(18)17-7-4-5-13-19-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;;/h2-13H,1H3;1-6,8-9H;1H;/q;-1;;+2/p-1 |
| InChIKey | WMFOETFJDPDMQH-UHFFFAOYSA-M |
| XLogP | 7.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 605.46 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine?
The IUPAC name of chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine (CID 139242717) is chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine.
What is the SMILES notation for chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine?
The canonical SMILES for chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine is Cc1ccc(S(=O)(=O)c2ccccc2-c2ccccn2)cc1.Cl[Pd+].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine?
The InChIKey is WMFOETFJDPDMQH-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15NO2S.C11H8N.ClH.Pd/c1-14-9-11-15(12-10-14)22(20,21)18-8-3-2-6-16(18)17-7-4-5-13-19-17;1-2-6-10(7-3-1)11-8-4-5-9-12-11;;/h2-13H,1H3;1-6,8-9H;1H;/q;-1;;+2/p-1.
What are the key properties of chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine?
chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine has a molecular weight of 605.46 g/mol, XLogP of 7.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloropalladium(1+);2-[2-(4-methylphenyl)sulfonylphenyl]pyridine;2-phenylpyridine is sourced from PubChem (CID 139242717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).