C28H28AuN3O4S2 — CID 54679768
gold(3+);2-(4-methylbenzene-6-id-1-yl)pyridine;(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylethyl]azanide (PubChem CID 54679768) has the molecular formula C28H28AuN3O4S2 and a molecular weight of 731.65 g/mol. Its IUPAC name is gold(3+);2-(4-methylbenzene-6-id-1-yl)pyridine;(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylethyl]azanide.
| Compound Name | gold(3+);2-(4-methylbenzene-6-id-1-yl)pyridine;(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylethyl]azanide |
|---|---|
| PubChem CID | 54679768 |
| Molecular Formula | C28H28AuN3O4S2 |
| Molecular Weight | 731.65 g/mol |
| Exact Mass | 731.12 |
| IUPAC Name | gold(3+);2-(4-methylbenzene-6-id-1-yl)pyridine;(4-methylphenyl)sulfonyl-[2-(4-methylphenyl)sulfonylazanidylethyl]azanide |
| SMILES | Cc1c[c-]c(-c2ccccn2)cc1.Cc1ccc(S(=O)(=O)[N-]CC[N-]S(=O)(=O)c2ccc(C)cc2)cc1.[Au+3] |
| InChI | InChI=1S/C16H18N2O4S2.C12H10N.Au/c1-13-3-7-15(8-4-13)23(19,20)17-11-12-18-24(21,22)16-9-5-14(2)6-10-16;1-10-5-7-11(8-6-10)12-4-2-3-9-13-12;/h3-10H,11-12H2,1-2H3;2-7,9H,1H3;/q-2;-1;+3 |
| InChIKey | POKFFBQECLEWQM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|