C18H26CuN4O4S2 — CID 139070893
copper bis(2-aminoethyl-(4-methylphenyl)sulfonylazanide) (PubChem CID 139070893) has the molecular formula C18H26CuN4O4S2 and a molecular weight of 490.11 g/mol. Its IUPAC name is copper bis(2-aminoethyl-(4-methylphenyl)sulfonylazanide).
| Compound Name | copper bis(2-aminoethyl-(4-methylphenyl)sulfonylazanide) |
|---|---|
| PubChem CID | 139070893 |
| Molecular Formula | C18H26CuN4O4S2 |
| Molecular Weight | 490.11 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | copper bis(2-aminoethyl-(4-methylphenyl)sulfonylazanide) |
| SMILES | Cc1ccc(S(=O)(=O)[N-]CCN)cc1.Cc1ccc(S(=O)(=O)[N-]CCN)cc1.[Cu+2] |
| InChI | InChI=1S/2C9H13N2O2S.Cu/c2*1-8-2-4-9(5-3-8)14(12,13)11-7-6-10;/h2*2-5H,6-7,10H2,1H3;/q2*-1;+2 |
| InChIKey | CSHXSKKSUIZOKK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |