C14H20LiNO2SSi — CID 134872083
lithium (4-methylphenyl)sulfonyl-(4-trimethylsilylbut-3-ynyl)azanide (PubChem CID 134872083) has the molecular formula C14H20LiNO2SSi and a molecular weight of 301.41 g/mol. Its IUPAC name is lithium (4-methylphenyl)sulfonyl-(4-trimethylsilylbut-3-ynyl)azanide.
| Compound Name | lithium (4-methylphenyl)sulfonyl-(4-trimethylsilylbut-3-ynyl)azanide |
|---|---|
| PubChem CID | 134872083 |
| Molecular Formula | C14H20LiNO2SSi |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | lithium (4-methylphenyl)sulfonyl-(4-trimethylsilylbut-3-ynyl)azanide |
| SMILES | Cc1ccc(S(=O)(=O)[N-]CCC#C[Si](C)(C)C)cc1.[Li+] |
| InChI | InChI=1S/C14H20NO2SSi.Li/c1-13-7-9-14(10-8-13)18(16,17)15-11-5-6-12-19(2,3)4;/h7-10H,5,11H2,1-4H3;/q-1;+1 |
| InChIKey | QOAOFBUUWASZTP-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|