About 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium
2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium (PubChem CID 144771535) has the molecular formula C9H12ClN2O2RuSY
and a molecular weight of 437.70 g/mol. Its IUPAC name is 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium.
Molecular Properties
| Compound Name | 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium |
| PubChem CID | 144771535 |
| Molecular Formula | C9H12ClN2O2RuSY |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.84 |
| IUPAC Name | 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium |
| SMILES | Cc1ccc(S(=O)(=O)[N-]CC[NH-])cc1.Cl[Ru+2].[Y] |
| InChI | InChI=1S/C9H12N2O2S.ClH.Ru.Y/c1-8-2-4-9(5-3-8)14(12,13)11-7-6-10;;;/h2-5,10H,6-7H2,1H3;1H;;/q-2;;+3;/p-1 |
| InChIKey | VSFVVEKTQXKFBN-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium?
The IUPAC name of 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium (CID 144771535) is 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium.
What is the SMILES notation for 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium?
The canonical SMILES for 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium is Cc1ccc(S(=O)(=O)[N-]CC[NH-])cc1.Cl[Ru+2].[Y].
What is the InChIKey of 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium?
The InChIKey is VSFVVEKTQXKFBN-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12N2O2S.ClH.Ru.Y/c1-8-2-4-9(5-3-8)14(12,13)11-7-6-10;;;/h2-5,10H,6-7H2,1H3;1H;;/q-2;;+3;/p-1.
What are the key properties of 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium?
2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium has a molecular weight of 437.70 g/mol, XLogP of 2.79, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azanidylethyl-(4-methylphenyl)sulfonylazanide;chlororuthenium(2+);yttrium is sourced from PubChem (CID 144771535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).