About bis-(4-methylphenyl)sulfonylazanide;gold(1+)
bis-(4-methylphenyl)sulfonylazanide;gold(1+) (PubChem CID 177449969) has the molecular formula C14H14AuNO4S2
and a molecular weight of 521.37 g/mol. Its IUPAC name is bis-(4-methylphenyl)sulfonylazanide;gold(1+).
Molecular Properties
| Compound Name | bis-(4-methylphenyl)sulfonylazanide;gold(1+) |
| PubChem CID | 177449969 |
| Molecular Formula | C14H14AuNO4S2 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | bis-(4-methylphenyl)sulfonylazanide;gold(1+) |
| SMILES | Cc1ccc(S(=O)(=O)[N-]S(=O)(=O)c2ccc(C)cc2)cc1.[Au+] |
| InChI | InChI=1S/C14H14NO4S2.Au/c1-11-3-7-13(8-4-11)20(16,17)15-21(18,19)14-9-5-12(2)6-10-14;/h3-10H,1-2H3;/q-1;+1 |
| InChIKey | FBAHCJPONVALLM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis-(4-methylphenyl)sulfonylazanide;gold(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis-(4-methylphenyl)sulfonylazanide;gold(1+)?
The IUPAC name of bis-(4-methylphenyl)sulfonylazanide;gold(1+) (CID 177449969) is bis-(4-methylphenyl)sulfonylazanide;gold(1+).
What is the SMILES notation for bis-(4-methylphenyl)sulfonylazanide;gold(1+)?
The canonical SMILES for bis-(4-methylphenyl)sulfonylazanide;gold(1+) is Cc1ccc(S(=O)(=O)[N-]S(=O)(=O)c2ccc(C)cc2)cc1.[Au+].
What is the InChIKey of bis-(4-methylphenyl)sulfonylazanide;gold(1+)?
The InChIKey is FBAHCJPONVALLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14NO4S2.Au/c1-11-3-7-13(8-4-11)20(16,17)15-21(18,19)14-9-5-12(2)6-10-14;/h3-10H,1-2H3;/q-1;+1.
What are the key properties of bis-(4-methylphenyl)sulfonylazanide;gold(1+)?
bis-(4-methylphenyl)sulfonylazanide;gold(1+) has a molecular weight of 521.37 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis-(4-methylphenyl)sulfonylazanide;gold(1+) is sourced from PubChem (CID 177449969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).