About dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate
dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate (PubChem CID 15978270) has the molecular formula C17H29NO2S2Sn
and a molecular weight of 462.27 g/mol. Its IUPAC name is dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate.
Molecular Properties
| Compound Name | dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate |
| PubChem CID | 15978270 |
| Molecular Formula | C17H29NO2S2Sn |
| Molecular Weight | 462.27 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate |
| SMILES | CCCC[Sn+2]CCCC.Cc1ccc(S(=O)(=O)[N-]CC[S-])cc1 |
| InChI | InChI=1S/C9H12NO2S2.2C4H9.Sn/c1-8-2-4-9(5-3-8)14(11,12)10-6-7-13;2*1-3-4-2;/h2-5,13H,6-7H2,1H3;2*1,3-4H2,2H3;/q-1;;;+2/p-1 |
| InChIKey | AYROPZMDMVUBTL-UHFFFAOYSA-M |
| XLogP | 4.73 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate?
The IUPAC name of dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate (CID 15978270) is dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate.
What is the SMILES notation for dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate?
The canonical SMILES for dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate is CCCC[Sn+2]CCCC.Cc1ccc(S(=O)(=O)[N-]CC[S-])cc1.
What is the InChIKey of dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate?
The InChIKey is AYROPZMDMVUBTL-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12NO2S2.2C4H9.Sn/c1-8-2-4-9(5-3-8)14(11,12)10-6-7-13;2*1-3-4-2;/h2-5,13H,6-7H2,1H3;2*1,3-4H2,2H3;/q-1;;;+2/p-1.
What are the key properties of dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate?
dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate has a molecular weight of 462.27 g/mol, XLogP of 4.73, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyltin(2+);2-(4-methylphenyl)sulfonylazanidylethanethiolate is sourced from PubChem (CID 15978270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).