About sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene
sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene (PubChem CID 88780829) has the molecular formula C27H19ClNNaO2S
and a molecular weight of 479.96 g/mol. Its IUPAC name is sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene.
Molecular Properties
| Compound Name | sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene |
| PubChem CID | 88780829 |
| Molecular Formula | C27H19ClNNaO2S |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene |
| SMILES | Cc1ccc(S(=O)(=O)[N-]Cl)cc1.[Na+].c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C7H7ClNO2S.Na/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;1-6-2-4-7(5-3-6)12(10,11)9-8;/h1-12H;2-5H,1H3;/q;-1;+1 |
| InChIKey | BYHPAOHDWGRKEX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene?
The IUPAC name of sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene (CID 88780829) is sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene.
What is the SMILES notation for sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene?
The canonical SMILES for sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene is Cc1ccc(S(=O)(=O)[N-]Cl)cc1.[Na+].c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene?
The InChIKey is BYHPAOHDWGRKEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C7H7ClNO2S.Na/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;1-6-2-4-7(5-3-6)12(10,11)9-8;/h1-12H;2-5H,1H3;/q;-1;+1.
What are the key properties of sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene?
sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene has a molecular weight of 479.96 g/mol, XLogP of 4.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;chloro-(4-methylphenyl)sulfonylazanide;perylene is sourced from PubChem (CID 88780829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).