C23H22ClNO3S2 — CID 10671635
(4-chlorophenyl)sulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide (PubChem CID 10671635) has the molecular formula C23H22ClNO3S2 and a molecular weight of 460.02 g/mol. Its IUPAC name is (4-chlorophenyl)sulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide.
| Compound Name | (4-chlorophenyl)sulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide |
|---|---|
| PubChem CID | 10671635 |
| Molecular Formula | C23H22ClNO3S2 |
| Molecular Weight | 460.02 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | (4-chlorophenyl)sulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide |
| SMILES | C[S+](C)C(C(=O)c1ccccc1)C([N-]S(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H22ClNO3S2/c1-29(2)23(22(26)18-11-7-4-8-12-18)21(17-9-5-3-6-10-17)25-30(27,28)20-15-13-19(24)14-16-20/h3-16,21,23H,1-2H3 |
| InChIKey | PGPZSSQUMDQSRZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.02 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|