C17H16N2O4S — CID 146128500
2-[(4-cyanophenyl)sulfonylamino]-2-(2,3-dimethylphenyl)acetic acid (PubChem CID 146128500) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonylamino]-2-(2,3-dimethylphenyl)acetic acid.
| Compound Name | 2-[(4-cyanophenyl)sulfonylamino]-2-(2,3-dimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 146128500 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonylamino]-2-(2,3-dimethylphenyl)acetic acid |
| SMILES | Cc1cccc(C(NS(=O)(=O)c2ccc(C#N)cc2)C(=O)O)c1C |
| InChI | InChI=1S/C17H16N2O4S/c1-11-4-3-5-15(12(11)2)16(17(20)21)19-24(22,23)14-8-6-13(10-18)7-9-14/h3-9,16,19H,1-2H3,(H,20,21) |
| InChIKey | YBKNTHRFYBHISU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |