C14H17N3O5S — CID 23050801
methyl 2-[(5-ethyl-3,4-dihydropyrazole-2-carbonyl)sulfamoyl]benzoate (PubChem CID 23050801) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is methyl 2-[(5-ethyl-3,4-dihydropyrazole-2-carbonyl)sulfamoyl]benzoate.
| Compound Name | methyl 2-[(5-ethyl-3,4-dihydropyrazole-2-carbonyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 23050801 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | methyl 2-[(5-ethyl-3,4-dihydropyrazole-2-carbonyl)sulfamoyl]benzoate |
| SMILES | CCC1=NN(C(=O)NS(=O)(=O)c2ccccc2C(=O)OC)CC1 |
| InChI | InChI=1S/C14H17N3O5S/c1-3-10-8-9-17(15-10)14(19)16-23(20,21)12-7-5-4-6-11(12)13(18)22-2/h4-7H,3,8-9H2,1-2H3,(H,16,19) |
| InChIKey | XGALQFAECJYZLV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |