C14H16N4NaO7S — CID 70172870
CID 70172870 (PubChem CID 70172870) has the molecular formula C14H16N4NaO7S and a molecular weight of 407.36 g/mol.
| Compound Name | CID 70172870 |
|---|---|
| PubChem CID | 70172870 |
| Molecular Formula | C14H16N4NaO7S |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | — |
| SMILES | CCOc1nn(C(=O)NS(=O)(=O)c2ccccc2C(=O)OC)c(=O)n1C.[Na] |
| InChI | InChI=1S/C14H16N4O7S.Na/c1-4-25-13-15-18(14(21)17(13)2)12(20)16-26(22,23)10-8-6-5-7-9(10)11(19)24-3;/h5-8H,4H2,1-3H3,(H,16,20); |
| InChIKey | KQHRMULDHGLUKN-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |