About CID 70172870
CID 70172870 (PubChem CID 70172870) has the molecular formula C14H16N4NaO7S
and a molecular weight of 407.36 g/mol.
Molecular Properties
| Compound Name | CID 70172870 |
| PubChem CID | 70172870 |
| Molecular Formula | C14H16N4NaO7S |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | — |
| SMILES | CCOc1nn(C(=O)NS(=O)(=O)c2ccccc2C(=O)OC)c(=O)n1C.[Na] |
| InChI | InChI=1S/C14H16N4O7S.Na/c1-4-25-13-15-18(14(21)17(13)2)12(20)16-26(22,23)10-8-6-5-7-9(10)11(19)24-3;/h5-8H,4H2,1-3H3,(H,16,20); |
| InChIKey | KQHRMULDHGLUKN-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze CID 70172870 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70172870?
The IUPAC name of CID 70172870 (CID 70172870) is not available.
What is the SMILES notation for CID 70172870?
The canonical SMILES for CID 70172870 is CCOc1nn(C(=O)NS(=O)(=O)c2ccccc2C(=O)OC)c(=O)n1C.[Na].
What is the InChIKey of CID 70172870?
The InChIKey is KQHRMULDHGLUKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O7S.Na/c1-4-25-13-15-18(14(21)17(13)2)12(20)16-26(22,23)10-8-6-5-7-9(10)11(19)24-3;/h5-8H,4H2,1-3H3,(H,16,20);.
What are the key properties of CID 70172870?
CID 70172870 has a molecular weight of 407.36 g/mol, XLogP of -0.67, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70172870 is sourced from PubChem (CID 70172870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).