C15H19N4NaO7S — CID 158308999
sodium;carbanide;2-[(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)sulfamoyl]benzoic acid (PubChem CID 158308999) has the molecular formula C15H19N4NaO7S and a molecular weight of 422.40 g/mol. Its IUPAC name is sodium;carbanide;2-[(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)sulfamoyl]benzoic acid.
| Compound Name | sodium;carbanide;2-[(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 158308999 |
| Molecular Formula | C15H19N4NaO7S |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | sodium;carbanide;2-[(4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carbonyl)sulfamoyl]benzoic acid |
| SMILES | CCCOc1nn(C(=O)NS(=O)(=O)c2ccccc2C(=O)O)c(=O)n1C.[CH3-].[Na+] |
| InChI | InChI=1S/C14H16N4O7S.CH3.Na/c1-3-8-25-13-15-18(14(22)17(13)2)12(21)16-26(23,24)10-7-5-4-6-9(10)11(19)20;;/h4-7H,3,8H2,1-2H3,(H,16,21)(H,19,20);1H3;/q;-1;+1 |
| InChIKey | ALFSIIFRSCUEQW-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 149.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|