C12H17N3O4S — CID 154852000
1-[(1R,2R)-2-hydroxycyclohexyl]-3-pyridin-2-ylsulfonylurea (PubChem CID 154852000) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxycyclohexyl]-3-pyridin-2-ylsulfonylurea.
| Compound Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-pyridin-2-ylsulfonylurea |
|---|---|
| PubChem CID | 154852000 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxycyclohexyl]-3-pyridin-2-ylsulfonylurea |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)NS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C12H17N3O4S/c16-10-6-2-1-5-9(10)14-12(17)15-20(18,19)11-7-3-4-8-13-11/h3-4,7-10,16H,1-2,5-6H2,(H2,14,15,17)/t9-,10-/m1/s1 |
| InChIKey | NHTABRRIURYORA-NXEZZACHSA-N |
| XLogP | 0.37 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |