C14H20N2O3S — CID 94027180
N-[(1S,2R)-2-methylcyclohexyl]-2-pyridin-2-ylsulfonylacetamide (PubChem CID 94027180) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-[(1S,2R)-2-methylcyclohexyl]-2-pyridin-2-ylsulfonylacetamide.
| Compound Name | N-[(1S,2R)-2-methylcyclohexyl]-2-pyridin-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 94027180 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[(1S,2R)-2-methylcyclohexyl]-2-pyridin-2-ylsulfonylacetamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)CS(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C14H20N2O3S/c1-11-6-2-3-7-12(11)16-13(17)10-20(18,19)14-8-4-5-9-15-14/h4-5,8-9,11-12H,2-3,6-7,10H2,1H3,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | OAZRFAIZMWTJOY-NEPJUHHUSA-N |
| XLogP | 1.55 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |