C21H16N2O3S — CID 134124422
N-pyridin-2-ylsulfonyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxamide (PubChem CID 134124422) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-pyridin-2-ylsulfonyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxamide.
| Compound Name | N-pyridin-2-ylsulfonyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxamide |
|---|---|
| PubChem CID | 134124422 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-pyridin-2-ylsulfonyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccn1)C1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C21H16N2O3S/c24-21(23-27(25,26)19-11-5-6-14-22-19)20-17-9-3-1-7-15(17)12-13-16-8-2-4-10-18(16)20/h1-14,20H,(H,23,24) |
| InChIKey | YJHJLNKXNLFXDI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|