C9H10N2O3S — CID 150675876
N-pyridin-2-ylsulfonylcyclopropanecarboxamide (PubChem CID 150675876) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is N-pyridin-2-ylsulfonylcyclopropanecarboxamide.
| Compound Name | N-pyridin-2-ylsulfonylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 150675876 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | N-pyridin-2-ylsulfonylcyclopropanecarboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccn1)C1CC1 |
| InChI | InChI=1S/C9H10N2O3S/c12-9(7-4-5-7)11-15(13,14)8-3-1-2-6-10-8/h1-3,6-7H,4-5H2,(H,11,12) |
| InChIKey | JGWNELCBQUCEGU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |