C13H14N2O4S — CID 154846144
(1S,2R,4S,5S,6R)-N-pyridin-2-ylsulfonyl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide (PubChem CID 154846144) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is (1S,2R,4S,5S,6R)-N-pyridin-2-ylsulfonyl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide.
| Compound Name | (1S,2R,4S,5S,6R)-N-pyridin-2-ylsulfonyl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
|---|---|
| PubChem CID | 154846144 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (1S,2R,4S,5S,6R)-N-pyridin-2-ylsulfonyl-8-oxatricyclo[3.2.1.02,4]octane-6-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccccn1)[C@@H]1C[C@@H]2O[C@H]1[C@H]1C[C@H]12 |
| InChI | InChI=1S/C13H14N2O4S/c16-13(9-6-10-7-5-8(7)12(9)19-10)15-20(17,18)11-3-1-2-4-14-11/h1-4,7-10,12H,5-6H2,(H,15,16)/t7-,8+,9-,10+,12+/m1/s1 |
| InChIKey | DSYFNKHNXHQFCG-ULHKAFAUSA-N |
| XLogP | 0.31 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |