C12H17N3O3S — CID 167993117
2-methyl-N-pyridazin-3-ylsulfonylcyclohexane-1-carboxamide (PubChem CID 167993117) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-methyl-N-pyridazin-3-ylsulfonylcyclohexane-1-carboxamide.
| Compound Name | 2-methyl-N-pyridazin-3-ylsulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167993117 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-methyl-N-pyridazin-3-ylsulfonylcyclohexane-1-carboxamide |
| SMILES | CC1CCCCC1C(=O)NS(=O)(=O)c1cccnn1 |
| InChI | InChI=1S/C12H17N3O3S/c1-9-5-2-3-6-10(9)12(16)15-19(17,18)11-7-4-8-13-14-11/h4,7-10H,2-3,5-6H2,1H3,(H,15,16) |
| InChIKey | XUAWLEFXKPLTOL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |