C17H24N3O4S- — CID 100950927
N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]ethanimidate (PubChem CID 100950927) has the molecular formula C17H24N3O4S- and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]ethanimidate.
| Compound Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]ethanimidate |
|---|---|
| PubChem CID | 100950927 |
| Molecular Formula | C17H24N3O4S- |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]ethanimidate |
| SMILES | C/C([O-])=N\CCc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C17H25N3O4S/c1-13(21)18-12-11-14-7-9-16(10-8-14)25(23,24)20-17(22)19-15-5-3-2-4-6-15/h7-10,15H,2-6,11-12H2,1H3,(H,18,21)(H2,19,20,22)/p-1 |
| InChIKey | IMMFXSGHFKGGMO-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|