C24H31N3O5S — CID 44567440
N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxy-5-methylbenzamide (PubChem CID 44567440) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxy-5-methylbenzamide.
| Compound Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 44567440 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxy-5-methylbenzamide |
| SMILES | COc1ccc(C)cc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-17-8-13-22(32-2)21(16-17)23(28)25-15-14-18-9-11-20(12-10-18)33(30,31)27-24(29)26-19-6-4-3-5-7-19/h8-13,16,19H,3-7,14-15H2,1-2H3,(H,25,28)(H2,26,27,29) |
| InChIKey | KTQTWSGFFVJHPP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |