C27H32N4O5S — CID 13124471
N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-ethyl-2-oxoquinoline-3-carboxamide (PubChem CID 13124471) has the molecular formula C27H32N4O5S and a molecular weight of 524.64 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-ethyl-2-oxoquinoline-3-carboxamide.
| Compound Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-ethyl-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 13124471 |
| Molecular Formula | C27H32N4O5S |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-ethyl-2-oxoquinoline-3-carboxamide |
| SMILES | CCn1c(=O)c(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC3CCCCC3)cc2)cc2ccccc21 |
| InChI | InChI=1S/C27H32N4O5S/c1-2-31-24-11-7-6-8-20(24)18-23(26(31)33)25(32)28-17-16-19-12-14-22(15-13-19)37(35,36)30-27(34)29-21-9-4-3-5-10-21/h6-8,11-15,18,21H,2-5,9-10,16-17H2,1H3,(H,28,32)(H2,29,30,34) |
| InChIKey | PDGOZHGHGZYWHW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |