C27H33N5O4S — CID 21433308
3-[2-[4-(cycloheptylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-quinolin-2-ylurea (PubChem CID 21433308) has the molecular formula C27H33N5O4S and a molecular weight of 523.66 g/mol. Its IUPAC name is 3-[2-[4-(cycloheptylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-quinolin-2-ylurea.
| Compound Name | 3-[2-[4-(cycloheptylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-quinolin-2-ylurea |
|---|---|
| PubChem CID | 21433308 |
| Molecular Formula | C27H33N5O4S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 3-[2-[4-(cycloheptylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-quinolin-2-ylurea |
| SMILES | CN(C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCCCCC2)cc1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C27H33N5O4S/c1-32(25-17-14-21-8-6-7-11-24(21)30-25)27(34)28-19-18-20-12-15-23(16-13-20)37(35,36)31-26(33)29-22-9-4-2-3-5-10-22/h6-8,11-17,22H,2-5,9-10,18-19H2,1H3,(H,28,34)(H2,29,31,33) |
| InChIKey | BAEJWGCSEHAOSR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |