C22H27N5O6S — CID 59767886
methyl 5-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethylcarbamoyl]pyrazine-2-carboxylate (PubChem CID 59767886) has the molecular formula C22H27N5O6S and a molecular weight of 489.55 g/mol. Its IUPAC name is methyl 5-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethylcarbamoyl]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethylcarbamoyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 59767886 |
| Molecular Formula | C22H27N5O6S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | methyl 5-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethylcarbamoyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC3CCCCC3)cc2)cn1 |
| InChI | InChI=1S/C22H27N5O6S/c1-33-21(29)19-14-24-18(13-25-19)20(28)23-12-11-15-7-9-17(10-8-15)34(31,32)27-22(30)26-16-5-3-2-4-6-16/h7-10,13-14,16H,2-6,11-12H2,1H3,(H,23,28)(H2,26,27,30) |
| InChIKey | HFGMTKKJAZISAV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 156.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |