C23H31N5O2S — CID 145139595
1-cyclohexyl-3-[methylidene-[4-[2-[1-(5-methylpyrazin-2-yl)ethenylamino]ethyl]phenyl]-oxo-λ6-sulfanyl]urea (PubChem CID 145139595) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is 1-cyclohexyl-3-[methylidene-[4-[2-[1-(5-methylpyrazin-2-yl)ethenylamino]ethyl]phenyl]-oxo-λ6-sulfanyl]urea.
| Compound Name | 1-cyclohexyl-3-[methylidene-[4-[2-[1-(5-methylpyrazin-2-yl)ethenylamino]ethyl]phenyl]-oxo-λ6-sulfanyl]urea |
|---|---|
| PubChem CID | 145139595 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-cyclohexyl-3-[methylidene-[4-[2-[1-(5-methylpyrazin-2-yl)ethenylamino]ethyl]phenyl]-oxo-λ6-sulfanyl]urea |
| SMILES | C=C(NCCc1ccc(S(=C)(=O)NC(=O)NC2CCCCC2)cc1)c1cnc(C)cn1 |
| InChI | InChI=1S/C23H31N5O2S/c1-17-15-26-22(16-25-17)18(2)24-14-13-19-9-11-21(12-10-19)31(3,30)28-23(29)27-20-7-5-4-6-8-20/h9-12,15-16,20,24H,2-8,13-14H2,1H3,(H2,27,28,29,30) |
| InChIKey | OQKXIESXOAVUFS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|