C27H41N6O7PS — CID 11578153
N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-5-[(2-diethoxyphosphorylethylamino)methyl]pyrazine-2-carboxamide (PubChem CID 11578153) has the molecular formula C27H41N6O7PS and a molecular weight of 624.70 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-5-[(2-diethoxyphosphorylethylamino)methyl]pyrazine-2-carboxamide.
| Compound Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-5-[(2-diethoxyphosphorylethylamino)methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11578153 |
| Molecular Formula | C27H41N6O7PS |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-5-[(2-diethoxyphosphorylethylamino)methyl]pyrazine-2-carboxamide |
| SMILES | CCOP(=O)(CCNCc1cnc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC3CCCCC3)cc2)cn1)OCC |
| InChI | InChI=1S/C27H41N6O7PS/c1-3-39-41(36,40-4-2)17-16-28-18-23-19-31-25(20-30-23)26(34)29-15-14-21-10-12-24(13-11-21)42(37,38)33-27(35)32-22-8-6-5-7-9-22/h10-13,19-20,22,28H,3-9,14-18H2,1-2H3,(H,29,34)(H2,32,33,35) |
| InChIKey | YGTMHRJTORKWFT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 177.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|