C22H29N5O4S — CID 21433328
3-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-pyridin-2-ylurea (PubChem CID 21433328) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is 3-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-pyridin-2-ylurea.
| Compound Name | 3-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-pyridin-2-ylurea |
|---|---|
| PubChem CID | 21433328 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 3-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-1-methyl-1-pyridin-2-ylurea |
| SMILES | CN(C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCCCC2)cc1)c1ccccn1 |
| InChI | InChI=1S/C22H29N5O4S/c1-27(20-9-5-6-15-23-20)22(29)24-16-14-17-10-12-19(13-11-17)32(30,31)26-21(28)25-18-7-3-2-4-8-18/h5-6,9-13,15,18H,2-4,7-8,14,16H2,1H3,(H,24,29)(H2,25,26,28) |
| InChIKey | DANPORWSQIYCPF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |