C22H22F5N3O4S — CID 10346554
N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 10346554) has the molecular formula C22H22F5N3O4S and a molecular weight of 519.49 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 10346554 |
| Molecular Formula | C22H22F5N3O4S |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NC1CCCCC1)NS(=O)(=O)c1ccc(CCNC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H22F5N3O4S/c23-16-15(17(24)19(26)20(27)18(16)25)21(31)28-11-10-12-6-8-14(9-7-12)35(33,34)30-22(32)29-13-4-2-1-3-5-13/h6-9,13H,1-5,10-11H2,(H,28,31)(H2,29,30,32) |
| InChIKey | IGNCMYQPYOPXOF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|