C23H16F7N3O4S — CID 20806542
N-[2-[4-[(2,3-difluoro-4-methylphenyl)carbamoylsulfamoyl]phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 20806542) has the molecular formula C23H16F7N3O4S and a molecular weight of 563.45 g/mol. Its IUPAC name is N-[2-[4-[(2,3-difluoro-4-methylphenyl)carbamoylsulfamoyl]phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[2-[4-[(2,3-difluoro-4-methylphenyl)carbamoylsulfamoyl]phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 20806542 |
| Molecular Formula | C23H16F7N3O4S |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | N-[2-[4-[(2,3-difluoro-4-methylphenyl)carbamoylsulfamoyl]phenyl]ethyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | Cc1ccc(NC(=O)NS(=O)(=O)c2ccc(CCNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)c(F)c1F |
| InChI | InChI=1S/C23H16F7N3O4S/c1-10-2-7-13(16(25)15(10)24)32-23(35)33-38(36,37)12-5-3-11(4-6-12)8-9-31-22(34)14-17(26)19(28)21(30)20(29)18(14)27/h2-7H,8-9H2,1H3,(H,31,34)(H2,32,33,35) |
| InChIKey | BAFBGSSPRJOUSY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|