C22H27ClN4O4S — CID 21388992
4-chloro-3-methyl-N-[2-[4-(piperidin-1-ylcarbamoylsulfamoyl)phenyl]ethyl]benzamide (PubChem CID 21388992) has the molecular formula C22H27ClN4O4S and a molecular weight of 479.00 g/mol. Its IUPAC name is 4-chloro-3-methyl-N-[2-[4-(piperidin-1-ylcarbamoylsulfamoyl)phenyl]ethyl]benzamide.
| Compound Name | 4-chloro-3-methyl-N-[2-[4-(piperidin-1-ylcarbamoylsulfamoyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 21388992 |
| Molecular Formula | C22H27ClN4O4S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 4-chloro-3-methyl-N-[2-[4-(piperidin-1-ylcarbamoylsulfamoyl)phenyl]ethyl]benzamide |
| SMILES | Cc1cc(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NN3CCCCC3)cc2)ccc1Cl |
| InChI | InChI=1S/C22H27ClN4O4S/c1-16-15-18(7-10-20(16)23)21(28)24-12-11-17-5-8-19(9-6-17)32(30,31)26-22(29)25-27-13-3-2-4-14-27/h5-10,15H,2-4,11-14H2,1H3,(H,24,28)(H2,25,26,29) |
| InChIKey | UJDDBVCEPOCXEO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |