C23H28ClN3O4S — CID 154385571
4-chloro-3-methyl-N-[[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]methyl]benzamide (PubChem CID 154385571) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is 4-chloro-3-methyl-N-[[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]methyl]benzamide.
| Compound Name | 4-chloro-3-methyl-N-[[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 154385571 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-chloro-3-methyl-N-[[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]methyl]benzamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(S(=O)(=O)NC(=O)NC3CCC(C)CC3)cc2)ccc1Cl |
| InChI | InChI=1S/C23H28ClN3O4S/c1-15-3-8-19(9-4-15)26-23(29)27-32(30,31)20-10-5-17(6-11-20)14-25-22(28)18-7-12-21(24)16(2)13-18/h5-7,10-13,15,19H,3-4,8-9,14H2,1-2H3,(H,25,28)(H2,26,27,29) |
| InChIKey | CCTJBUZZZYLITC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |