C29H31FIN3O5S — CID 10372384
N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-[(4-fluorophenyl)methoxy]-5-iodobenzamide (PubChem CID 10372384) has the molecular formula C29H31FIN3O5S and a molecular weight of 679.55 g/mol. Its IUPAC name is N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-[(4-fluorophenyl)methoxy]-5-iodobenzamide.
| Compound Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-[(4-fluorophenyl)methoxy]-5-iodobenzamide |
|---|---|
| PubChem CID | 10372384 |
| Molecular Formula | C29H31FIN3O5S |
| Molecular Weight | 679.55 g/mol |
| Exact Mass | 679.10 |
| IUPAC Name | N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-[(4-fluorophenyl)methoxy]-5-iodobenzamide |
| SMILES | O=C(NC1CCCCC1)NS(=O)(=O)c1ccc(CCNC(=O)c2cc(I)ccc2OCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H31FIN3O5S/c30-22-10-6-21(7-11-22)19-39-27-15-12-23(31)18-26(27)28(35)32-17-16-20-8-13-25(14-9-20)40(37,38)34-29(36)33-24-4-2-1-3-5-24/h6-15,18,24H,1-5,16-17,19H2,(H,32,35)(H2,33,34,36) |
| InChIKey | ZXVHHWUGIFCHTL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|