C29H40IN6O7S+ — CID 177366020
diaminomethylidene-[5-[4-[[4-[2-[(5-iodo-2-methoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamoylamino]cyclohexyl]oxy-5-oxopentyl]azanium (PubChem CID 177366020) has the molecular formula C29H40IN6O7S+ and a molecular weight of 743.64 g/mol. Its IUPAC name is diaminomethylidene-[5-[4-[[4-[2-[(5-iodo-2-methoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamoylamino]cyclohexyl]oxy-5-oxopentyl]azanium.
| Compound Name | diaminomethylidene-[5-[4-[[4-[2-[(5-iodo-2-methoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamoylamino]cyclohexyl]oxy-5-oxopentyl]azanium |
|---|---|
| PubChem CID | 177366020 |
| Molecular Formula | C29H40IN6O7S+ |
| Molecular Weight | 743.64 g/mol |
| Exact Mass | 743.17 |
| IUPAC Name | diaminomethylidene-[5-[4-[[4-[2-[(5-iodo-2-methoxybenzoyl)amino]ethyl]phenyl]sulfonylcarbamoylamino]cyclohexyl]oxy-5-oxopentyl]azanium |
| SMILES | COc1ccc(I)cc1C(=O)NCCc1ccc(S(=O)(=O)NC(=O)NC2CCC(OC(=O)CCCC[NH+]=C(N)N)CC2)cc1 |
| InChI | InChI=1S/C29H39IN6O7S/c1-42-25-14-7-20(30)18-24(25)27(38)33-17-15-19-5-12-23(13-6-19)44(40,41)36-29(39)35-21-8-10-22(11-9-21)43-26(37)4-2-3-16-34-28(31)32/h5-7,12-14,18,21-22H,2-4,8-11,15-17H2,1H3,(H,33,38)(H4,31,32,34)(H2,35,36,39)/p+1 |
| InChIKey | NWTWHZOZIFWGEH-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 205.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.64 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|