C12H16N3O4S2+ — CID 6337895
1-(4-methylphenyl)sulfonyl-3-(4-sulfanylidenemorpholin-4-ium-2-yl)urea (PubChem CID 6337895) has the molecular formula C12H16N3O4S2+ and a molecular weight of 330.41 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-(4-sulfanylidenemorpholin-4-ium-2-yl)urea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-(4-sulfanylidenemorpholin-4-ium-2-yl)urea |
|---|---|
| PubChem CID | 6337895 |
| Molecular Formula | C12H16N3O4S2+ |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-(4-sulfanylidenemorpholin-4-ium-2-yl)urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NC2C[N+](=S)CCO2)cc1 |
| InChI | InChI=1S/C12H15N3O4S2/c1-9-2-4-10(5-3-9)21(17,18)14-12(16)13-11-8-15(20)6-7-19-11/h2-5,11H,6-8H2,1H3,(H-,13,14,16)/p+1 |
| InChIKey | BZCFGUHQUMTKIG-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|