C15H23N3O2S — CID 61211616
N-cyclopropyl-4-[(1-methylpiperidin-3-yl)amino]benzenesulfonamide (PubChem CID 61211616) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-cyclopropyl-4-[(1-methylpiperidin-3-yl)amino]benzenesulfonamide.
| Compound Name | N-cyclopropyl-4-[(1-methylpiperidin-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 61211616 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-cyclopropyl-4-[(1-methylpiperidin-3-yl)amino]benzenesulfonamide |
| SMILES | CN1CCCC(Nc2ccc(S(=O)(=O)NC3CC3)cc2)C1 |
| InChI | InChI=1S/C15H23N3O2S/c1-18-10-2-3-14(11-18)16-12-6-8-15(9-7-12)21(19,20)17-13-4-5-13/h6-9,13-14,16-17H,2-5,10-11H2,1H3 |
| InChIKey | CDQFRQDJZZSFPB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |