C11H14FNO — CID 97358489
(2R,3S)-N-(3-fluorophenyl)-2-methyloxolan-3-amine (PubChem CID 97358489) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is (2R,3S)-N-(3-fluorophenyl)-2-methyloxolan-3-amine.
| Compound Name | (2R,3S)-N-(3-fluorophenyl)-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 97358489 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (2R,3S)-N-(3-fluorophenyl)-2-methyloxolan-3-amine |
| SMILES | C[C@H]1OCC[C@@H]1Nc1cccc(F)c1 |
| InChI | InChI=1S/C11H14FNO/c1-8-11(5-6-14-8)13-10-4-2-3-9(12)7-10/h2-4,7-8,11,13H,5-6H2,1H3/t8-,11+/m1/s1 |
| InChIKey | PFANCMKLLNEDQG-KCJUWKMLSA-N |
| XLogP | 2.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |