C12H16FNO — CID 97358660
(2R,3S)-N-(3-fluoro-5-methylphenyl)-2-methyloxolan-3-amine (PubChem CID 97358660) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is (2R,3S)-N-(3-fluoro-5-methylphenyl)-2-methyloxolan-3-amine.
| Compound Name | (2R,3S)-N-(3-fluoro-5-methylphenyl)-2-methyloxolan-3-amine |
|---|---|
| PubChem CID | 97358660 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2R,3S)-N-(3-fluoro-5-methylphenyl)-2-methyloxolan-3-amine |
| SMILES | Cc1cc(F)cc(N[C@H]2CCO[C@@H]2C)c1 |
| InChI | InChI=1S/C12H16FNO/c1-8-5-10(13)7-11(6-8)14-12-3-4-15-9(12)2/h5-7,9,12,14H,3-4H2,1-2H3/t9-,12+/m1/s1 |
| InChIKey | SHACQHLMHFVYKO-SKDRFNHKSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |