About N-(3,3-difluorocyclohexyl)-3-fluoroaniline
N-(3,3-difluorocyclohexyl)-3-fluoroaniline (PubChem CID 170406630) has the molecular formula C12H14F3N
and a molecular weight of 229.24 g/mol. Its IUPAC name is N-(3,3-difluorocyclohexyl)-3-fluoroaniline.
Molecular Properties
| Compound Name | N-(3,3-difluorocyclohexyl)-3-fluoroaniline |
| PubChem CID | 170406630 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(3,3-difluorocyclohexyl)-3-fluoroaniline |
| SMILES | Fc1cccc(NC2CCCC(F)(F)C2)c1 |
| InChI | InChI=1S/C12H14F3N/c13-9-3-1-4-10(7-9)16-11-5-2-6-12(14,15)8-11/h1,3-4,7,11,16H,2,5-6,8H2 |
| InChIKey | FYAGBOLVJXTINI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,3-difluorocyclohexyl)-3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluorocyclohexyl)-3-fluoroaniline?
The IUPAC name of N-(3,3-difluorocyclohexyl)-3-fluoroaniline (CID 170406630) is N-(3,3-difluorocyclohexyl)-3-fluoroaniline.
What is the SMILES notation for N-(3,3-difluorocyclohexyl)-3-fluoroaniline?
The canonical SMILES for N-(3,3-difluorocyclohexyl)-3-fluoroaniline is Fc1cccc(NC2CCCC(F)(F)C2)c1.
What is the InChIKey of N-(3,3-difluorocyclohexyl)-3-fluoroaniline?
The InChIKey is FYAGBOLVJXTINI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N/c13-9-3-1-4-10(7-9)16-11-5-2-6-12(14,15)8-11/h1,3-4,7,11,16H,2,5-6,8H2.
What are the key properties of N-(3,3-difluorocyclohexyl)-3-fluoroaniline?
N-(3,3-difluorocyclohexyl)-3-fluoroaniline has a molecular weight of 229.24 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluorocyclohexyl)-3-fluoroaniline is sourced from PubChem (CID 170406630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).