C13H17F2N — CID 80693379
N-(3,3-dimethylcyclopentyl)-3,5-difluoroaniline (PubChem CID 80693379) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-3,5-difluoroaniline.
| Compound Name | N-(3,3-dimethylcyclopentyl)-3,5-difluoroaniline |
|---|---|
| PubChem CID | 80693379 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-3,5-difluoroaniline |
| SMILES | CC1(C)CCC(Nc2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C13H17F2N/c1-13(2)4-3-11(8-13)16-12-6-9(14)5-10(15)7-12/h5-7,11,16H,3-4,8H2,1-2H3 |
| InChIKey | CVTSEVFCUMHVQJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |