C16H24N2O — CID 104613034
1-[2-amino-5-[(3,3-dimethylcyclohexyl)amino]phenyl]ethanone (PubChem CID 104613034) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-[2-amino-5-[(3,3-dimethylcyclohexyl)amino]phenyl]ethanone.
| Compound Name | 1-[2-amino-5-[(3,3-dimethylcyclohexyl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 104613034 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-[2-amino-5-[(3,3-dimethylcyclohexyl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1cc(NC2CCCC(C)(C)C2)ccc1N |
| InChI | InChI=1S/C16H24N2O/c1-11(19)14-9-12(6-7-15(14)17)18-13-5-4-8-16(2,3)10-13/h6-7,9,13,18H,4-5,8,10,17H2,1-3H3 |
| InChIKey | FISWQJARPHLAST-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|