C15H22N2O2 — CID 112579341
3-amino-2-[(3,3-dimethylcyclohexyl)amino]benzoic acid (PubChem CID 112579341) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-amino-2-[(3,3-dimethylcyclohexyl)amino]benzoic acid.
| Compound Name | 3-amino-2-[(3,3-dimethylcyclohexyl)amino]benzoic acid |
|---|---|
| PubChem CID | 112579341 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-amino-2-[(3,3-dimethylcyclohexyl)amino]benzoic acid |
| SMILES | CC1(C)CCCC(Nc2c(N)cccc2C(=O)O)C1 |
| InChI | InChI=1S/C15H22N2O2/c1-15(2)8-4-5-10(9-15)17-13-11(14(18)19)6-3-7-12(13)16/h3,6-7,10,17H,4-5,8-9,16H2,1-2H3,(H,18,19) |
| InChIKey | HZDJNLVHRUYHIX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|