C12H16ClNOS — CID 107295304
2-chloro-4-[(thiolan-3-ylmethylamino)methyl]phenol (PubChem CID 107295304) has the molecular formula C12H16ClNOS and a molecular weight of 257.79 g/mol. Its IUPAC name is 2-chloro-4-[(thiolan-3-ylmethylamino)methyl]phenol.
| Compound Name | 2-chloro-4-[(thiolan-3-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 107295304 |
| Molecular Formula | C12H16ClNOS |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 2-chloro-4-[(thiolan-3-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccc(CNCC2CCSC2)cc1Cl |
| InChI | InChI=1S/C12H16ClNOS/c13-11-5-9(1-2-12(11)15)6-14-7-10-3-4-16-8-10/h1-2,5,10,14-15H,3-4,6-8H2 |
| InChIKey | RGDBSVZWRYLMRC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |