About 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol
4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 106125210) has the molecular formula C15H20BrNO3
and a molecular weight of 342.23 g/mol. Its IUPAC name is 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol |
| PubChem CID | 106125210 |
| Molecular Formula | C15H20BrNO3 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCC(CNCc2cc3c(cc2Br)OCO3)CC1 |
| InChI | InChI=1S/C15H20BrNO3/c16-13-6-15-14(19-9-20-15)5-11(13)8-17-7-10-1-3-12(18)4-2-10/h5-6,10,12,17-18H,1-4,7-9H2 |
| InChIKey | CWOBZTSYSAEBQQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol?
The IUPAC name of 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol (CID 106125210) is 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol.
What is the SMILES notation for 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol?
The canonical SMILES for 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol is OC1CCC(CNCc2cc3c(cc2Br)OCO3)CC1.
What is the InChIKey of 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol?
The InChIKey is CWOBZTSYSAEBQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrNO3/c16-13-6-15-14(19-9-20-15)5-11(13)8-17-7-10-1-3-12(18)4-2-10/h5-6,10,12,17-18H,1-4,7-9H2.
What are the key properties of 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol?
4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol has a molecular weight of 342.23 g/mol, XLogP of 2.82, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(6-bromo-1,3-benzodioxol-5-yl)methylamino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 106125210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).