C13H14BrF3N2O2 — CID 107342374
5-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]pyrrolidin-2-one (PubChem CID 107342374) has the molecular formula C13H14BrF3N2O2 and a molecular weight of 367.17 g/mol. Its IUPAC name is 5-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]pyrrolidin-2-one.
| Compound Name | 5-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 107342374 |
| Molecular Formula | C13H14BrF3N2O2 |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-[[[3-bromo-4-(trifluoromethoxy)phenyl]methylamino]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CNCc2ccc(OC(F)(F)F)c(Br)c2)N1 |
| InChI | InChI=1S/C13H14BrF3N2O2/c14-10-5-8(1-3-11(10)21-13(15,16)17)6-18-7-9-2-4-12(20)19-9/h1,3,5,9,18H,2,4,6-7H2,(H,19,20) |
| InChIKey | WMZNNWQWVLYAKV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |