C14H22ClO2P — CID 172814353
butyl-[4-(3-chlorophenyl)butyl]phosphinic acid (PubChem CID 172814353) has the molecular formula C14H22ClO2P and a molecular weight of 288.75 g/mol. Its IUPAC name is butyl-[4-(3-chlorophenyl)butyl]phosphinic acid.
| Compound Name | butyl-[4-(3-chlorophenyl)butyl]phosphinic acid |
|---|---|
| PubChem CID | 172814353 |
| Molecular Formula | C14H22ClO2P |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | butyl-[4-(3-chlorophenyl)butyl]phosphinic acid |
| SMILES | CCCCP(=O)(O)CCCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H22ClO2P/c1-2-3-10-18(16,17)11-5-4-7-13-8-6-9-14(15)12-13/h6,8-9,12H,2-5,7,10-11H2,1H3,(H,16,17) |
| InChIKey | SPOQTMXKFUNRPK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|