C16H21ClN4 — CID 105363453
N-[3-(3-chloropropyl)phenyl]-5,6-diethyl-1,2,4-triazin-3-amine (PubChem CID 105363453) has the molecular formula C16H21ClN4 and a molecular weight of 304.83 g/mol. Its IUPAC name is N-[3-(3-chloropropyl)phenyl]-5,6-diethyl-1,2,4-triazin-3-amine.
| Compound Name | N-[3-(3-chloropropyl)phenyl]-5,6-diethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 105363453 |
| Molecular Formula | C16H21ClN4 |
| Molecular Weight | 304.83 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-[3-(3-chloropropyl)phenyl]-5,6-diethyl-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(Nc2cccc(CCCCl)c2)nc1CC |
| InChI | InChI=1S/C16H21ClN4/c1-3-14-15(4-2)20-21-16(19-14)18-13-9-5-7-12(11-13)8-6-10-17/h5,7,9,11H,3-4,6,8,10H2,1-2H3,(H,18,19,21) |
| InChIKey | SDOAZFZJWQANJQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|