C14H15BrN4O2 — CID 105362170
2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid (PubChem CID 105362170) has the molecular formula C14H15BrN4O2 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid.
| Compound Name | 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 105362170 |
| Molecular Formula | C14H15BrN4O2 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid |
| SMILES | CCc1nnc(Nc2ccc(Br)c(C(=O)O)c2)nc1CC |
| InChI | InChI=1S/C14H15BrN4O2/c1-3-11-12(4-2)18-19-14(17-11)16-8-5-6-10(15)9(7-8)13(20)21/h5-7H,3-4H2,1-2H3,(H,20,21)(H,16,17,19) |
| InChIKey | MGSCXSLCKAJAEV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |