2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid

C14H15BrN4O2 — CID 105362170

IUPAC2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid
SMILESCCc1nnc(Nc2ccc(Br)c(C(=O)O)c2)nc1CC
InChIInChI=1S/C14H15BrN4O2/c1-3-11-12(4-2)18-19-14(17-11)16-8-5-6-10(15)9(7-8)13(20)21/h5-7H,3-4H2,1-2H3,(H,20,21)(H,16,17,19)
InChIKeyMGSCXSLCKAJAEV-UHFFFAOYSA-N
MW351.20 g/mol
LogP3.20
Rot. Bonds5

About 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid

2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid (PubChem CID 105362170) has the molecular formula C14H15BrN4O2 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid.

Molecular Properties

Compound Name2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid
PubChem CID105362170
Molecular FormulaC14H15BrN4O2
Molecular Weight351.20 g/mol
Exact Mass350.04
IUPAC Name2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid
SMILESCCc1nnc(Nc2ccc(Br)c(C(=O)O)c2)nc1CC
InChIInChI=1S/C14H15BrN4O2/c1-3-11-12(4-2)18-19-14(17-11)16-8-5-6-10(15)9(7-8)13(20)21/h5-7H,3-4H2,1-2H3,(H,20,21)(H,16,17,19)
InChIKeyMGSCXSLCKAJAEV-UHFFFAOYSA-N
XLogP3.20
TPSA88.00 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500351.20
LogP ≤ 53.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid?
The IUPAC name of 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid (CID 105362170) is 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid.
What is the SMILES notation for 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid?
The canonical SMILES for 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid is CCc1nnc(Nc2ccc(Br)c(C(=O)O)c2)nc1CC.
What is the InChIKey of 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid?
The InChIKey is MGSCXSLCKAJAEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrN4O2/c1-3-11-12(4-2)18-19-14(17-11)16-8-5-6-10(15)9(7-8)13(20)21/h5-7H,3-4H2,1-2H3,(H,20,21)(H,16,17,19).
What are the key properties of 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid?
2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid has a molecular weight of 351.20 g/mol, XLogP of 3.20, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[(5,6-diethyl-1,2,4-triazin-3-yl)amino]benzoic acid is sourced from PubChem (CID 105362170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).