C10H10N6O3 — CID 2722141
5-[(5,6-diamino-1,2,4-triazin-3-yl)amino]-2-hydroxybenzoic acid (PubChem CID 2722141) has the molecular formula C10H10N6O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 5-[(5,6-diamino-1,2,4-triazin-3-yl)amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[(5,6-diamino-1,2,4-triazin-3-yl)amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 2722141 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-[(5,6-diamino-1,2,4-triazin-3-yl)amino]-2-hydroxybenzoic acid |
| SMILES | Nc1nnc(Nc2ccc(O)c(C(=O)O)c2)nc1N |
| InChI | InChI=1S/C10H10N6O3/c11-7-8(12)15-16-10(14-7)13-4-1-2-6(17)5(3-4)9(18)19/h1-3,17H,(H2,12,15)(H,18,19)(H3,11,13,14,16) |
| InChIKey | CSMZLQPPRGUFRA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 160.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|